C19H19ClN2O3S — CID 7916179
(3-chlorophenyl)-[2-(3,4-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]methanone (PubChem CID 7916179) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is (3-chlorophenyl)-[2-(3,4-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]methanone.
| Compound Name | (3-chlorophenyl)-[2-(3,4-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]methanone |
|---|---|
| PubChem CID | 7916179 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (3-chlorophenyl)-[2-(3,4-dimethoxyphenyl)imino-1,3-thiazinan-3-yl]methanone |
| SMILES | COc1ccc(/N=C2\SCCCN2C(=O)c2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C19H19ClN2O3S/c1-24-16-8-7-15(12-17(16)25-2)21-19-22(9-4-10-26-19)18(23)13-5-3-6-14(20)11-13/h3,5-8,11-12H,4,9-10H2,1-2H3/b21-19- |
| InChIKey | JJEMVMDYXVKHBX-VZCXRCSSSA-N |
| XLogP | 4.62 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|