C18H20ClN3O3S3 — CID 16560718
N-[2-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide (PubChem CID 16560718) has the molecular formula C18H20ClN3O3S3 and a molecular weight of 458.03 g/mol. Its IUPAC name is N-[2-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide.
| Compound Name | N-[2-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 16560718 |
| Molecular Formula | C18H20ClN3O3S3 |
| Molecular Weight | 458.03 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | N-[2-[2-(3-chloro-4-methylphenyl)imino-1,3-thiazinan-3-yl]-2-oxoethyl]-N-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(/N=C2\SCCCN2C(=O)CN(C)S(=O)(=O)c2cccs2)cc1Cl |
| InChI | InChI=1S/C18H20ClN3O3S3/c1-13-6-7-14(11-15(13)19)20-18-22(8-4-10-27-18)16(23)12-21(2)28(24,25)17-5-3-9-26-17/h3,5-7,9,11H,4,8,10,12H2,1-2H3/b20-18- |
| InChIKey | BTCZTNKVVQSLDU-ZZEZOPTASA-N |
| XLogP | 3.98 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.03 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|