C26H21Br2F4N3OS2 — CID 88765200
2-[1-(3,5-dibromophenyl)-1-phenylethyl]imino-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide (PubChem CID 88765200) has the molecular formula C26H21Br2F4N3OS2 and a molecular weight of 691.41 g/mol. Its IUPAC name is 2-[1-(3,5-dibromophenyl)-1-phenylethyl]imino-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide.
| Compound Name | 2-[1-(3,5-dibromophenyl)-1-phenylethyl]imino-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 88765200 |
| Molecular Formula | C26H21Br2F4N3OS2 |
| Molecular Weight | 691.41 g/mol |
| Exact Mass | 688.94 |
| IUPAC Name | 2-[1-(3,5-dibromophenyl)-1-phenylethyl]imino-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide |
| SMILES | CC(/N=C1\SCCN1C(=S)Nc1cccc(OC(F)(F)C(F)F)c1)(c1ccccc1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C26H21Br2F4N3OS2/c1-25(16-6-3-2-4-7-16,17-12-18(27)14-19(28)13-17)34-24-35(10-11-38-24)23(37)33-20-8-5-9-21(15-20)36-26(31,32)22(29)30/h2-9,12-15,22H,10-11H2,1H3,(H,33,37)/b34-24- |
| InChIKey | XXTZCOAODXWWQA-BCJTWVECSA-N |
| XLogP | 8.51 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.41 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|