C17H14BrF3N2S2 — CID 1043560
(2S)-2-(4-bromophenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carbothioamide (PubChem CID 1043560) has the molecular formula C17H14BrF3N2S2 and a molecular weight of 447.35 g/mol. Its IUPAC name is (2S)-2-(4-bromophenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carbothioamide.
| Compound Name | (2S)-2-(4-bromophenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 1043560 |
| Molecular Formula | C17H14BrF3N2S2 |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 445.97 |
| IUPAC Name | (2S)-2-(4-bromophenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine-3-carbothioamide |
| SMILES | FC(F)(F)c1cccc(NC(=S)N2CCS[C@H]2c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H14BrF3N2S2/c18-13-6-4-11(5-7-13)15-23(8-9-25-15)16(24)22-14-3-1-2-12(10-14)17(19,20)21/h1-7,10,15H,8-9H2,(H,22,24)/t15-/m0/s1 |
| InChIKey | DROWEFDSJWWLCA-HNNXBMFYSA-N |
| XLogP | 5.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|