C17H17BrN2S2 — CID 12783516
N-(3-bromophenyl)-2-phenyl-1,3-thiazinane-3-carbothioamide (PubChem CID 12783516) has the molecular formula C17H17BrN2S2 and a molecular weight of 393.38 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-phenyl-1,3-thiazinane-3-carbothioamide.
| Compound Name | N-(3-bromophenyl)-2-phenyl-1,3-thiazinane-3-carbothioamide |
|---|---|
| PubChem CID | 12783516 |
| Molecular Formula | C17H17BrN2S2 |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | N-(3-bromophenyl)-2-phenyl-1,3-thiazinane-3-carbothioamide |
| SMILES | S=C(Nc1cccc(Br)c1)N1CCCSC1c1ccccc1 |
| InChI | InChI=1S/C17H17BrN2S2/c18-14-8-4-9-15(12-14)19-17(21)20-10-5-11-22-16(20)13-6-2-1-3-7-13/h1-4,6-9,12,16H,5,10-11H2,(H,19,21) |
| InChIKey | JGRWTLVVIDOKDZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|