C15H20N2S — CID 113241526
N-phenyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carbothioamide (PubChem CID 113241526) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is N-phenyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carbothioamide.
| Compound Name | N-phenyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carbothioamide |
|---|---|
| PubChem CID | 113241526 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-phenyl-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine-1-carbothioamide |
| SMILES | S=C(Nc1ccccc1)N1CCCC2CCCC21 |
| InChI | InChI=1S/C15H20N2S/c18-15(16-13-8-2-1-3-9-13)17-11-5-7-12-6-4-10-14(12)17/h1-3,8-9,12,14H,4-7,10-11H2,(H,16,18) |
| InChIKey | HGESCDCBNKPFFB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|