C12H12F4N2OS2 — CID 88765778
N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide (PubChem CID 88765778) has the molecular formula C12H12F4N2OS2 and a molecular weight of 340.37 g/mol. Its IUPAC name is N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 88765778 |
| Molecular Formula | C12H12F4N2OS2 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide |
| SMILES | FC(F)C(F)(F)Oc1cccc(NC(=S)N2CCSC2)c1 |
| InChI | InChI=1S/C12H12F4N2OS2/c13-10(14)12(15,16)19-9-3-1-2-8(6-9)17-11(20)18-4-5-21-7-18/h1-3,6,10H,4-5,7H2,(H,17,20) |
| InChIKey | PPBWCMHFMOTSGK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|