C25H30F4N4OS2 — CID 88770811
2-[hexyl(phenyl)hydrazinylidene]-4-methyl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide (PubChem CID 88770811) has the molecular formula C25H30F4N4OS2 and a molecular weight of 542.67 g/mol. Its IUPAC name is 2-[hexyl(phenyl)hydrazinylidene]-4-methyl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide.
| Compound Name | 2-[hexyl(phenyl)hydrazinylidene]-4-methyl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 88770811 |
| Molecular Formula | C25H30F4N4OS2 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 2-[hexyl(phenyl)hydrazinylidene]-4-methyl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,3-thiazolidine-3-carbothioamide |
| SMILES | CCCCCCN(N=C1SCC(C)N1C(=S)Nc1cccc(OC(F)(F)C(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C25H30F4N4OS2/c1-3-4-5-9-15-32(20-12-7-6-8-13-20)31-24-33(18(2)17-36-24)23(35)30-19-11-10-14-21(16-19)34-25(28,29)22(26)27/h6-8,10-14,16,18,22H,3-5,9,15,17H2,1-2H3,(H,30,35) |
| InChIKey | CLCXUHZSSCOXHQ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|