C19H31FN2S — CID 19653368
3-(3-fluorophenyl)-1,1-dihexylthiourea (PubChem CID 19653368) has the molecular formula C19H31FN2S and a molecular weight of 338.54 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1,1-dihexylthiourea.
| Compound Name | 3-(3-fluorophenyl)-1,1-dihexylthiourea |
|---|---|
| PubChem CID | 19653368 |
| Molecular Formula | C19H31FN2S |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 3-(3-fluorophenyl)-1,1-dihexylthiourea |
| SMILES | CCCCCCN(CCCCCC)C(=S)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H31FN2S/c1-3-5-7-9-14-22(15-10-8-6-4-2)19(23)21-18-13-11-12-17(20)16-18/h11-13,16H,3-10,14-15H2,1-2H3,(H,21,23) |
| InChIKey | HRJTYSRDCHGTID-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|