C14H23FN2 — CID 62561317
N-(3-fluorophenyl)-N'-methyl-N'-pentylethane-1,2-diamine (PubChem CID 62561317) has the molecular formula C14H23FN2 and a molecular weight of 238.35 g/mol. Its IUPAC name is N-(3-fluorophenyl)-N'-methyl-N'-pentylethane-1,2-diamine.
| Compound Name | N-(3-fluorophenyl)-N'-methyl-N'-pentylethane-1,2-diamine |
|---|---|
| PubChem CID | 62561317 |
| Molecular Formula | C14H23FN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | N-(3-fluorophenyl)-N'-methyl-N'-pentylethane-1,2-diamine |
| SMILES | CCCCCN(C)CCNc1cccc(F)c1 |
| InChI | InChI=1S/C14H23FN2/c1-3-4-5-10-17(2)11-9-16-14-8-6-7-13(15)12-14/h6-8,12,16H,3-5,9-11H2,1-2H3 |
| InChIKey | IKFAOXSVBVWPNX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|