C15H20F4N2O — CID 59231322
N-[(4-aminocyclohexyl)methyl]-3-(1,1,2,2-tetrafluoroethoxy)aniline (PubChem CID 59231322) has the molecular formula C15H20F4N2O and a molecular weight of 320.33 g/mol. Its IUPAC name is N-[(4-aminocyclohexyl)methyl]-3-(1,1,2,2-tetrafluoroethoxy)aniline.
| Compound Name | N-[(4-aminocyclohexyl)methyl]-3-(1,1,2,2-tetrafluoroethoxy)aniline |
|---|---|
| PubChem CID | 59231322 |
| Molecular Formula | C15H20F4N2O |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[(4-aminocyclohexyl)methyl]-3-(1,1,2,2-tetrafluoroethoxy)aniline |
| SMILES | NC1CCC(CNc2cccc(OC(F)(F)C(F)F)c2)CC1 |
| InChI | InChI=1S/C15H20F4N2O/c16-14(17)15(18,19)22-13-3-1-2-12(8-13)21-9-10-4-6-11(20)7-5-10/h1-3,8,10-11,14,21H,4-7,9,20H2 |
| InChIKey | JYCUYVVMYWADPN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|