C18H26F4N2O3S — CID 118376558
N-[4-[[3-(1,1,2,2-tetrafluoroethoxy)anilino]methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 118376558) has the molecular formula C18H26F4N2O3S and a molecular weight of 426.48 g/mol. Its IUPAC name is N-[4-[[3-(1,1,2,2-tetrafluoroethoxy)anilino]methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | N-[4-[[3-(1,1,2,2-tetrafluoroethoxy)anilino]methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 118376558 |
| Molecular Formula | C18H26F4N2O3S |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N-[4-[[3-(1,1,2,2-tetrafluoroethoxy)anilino]methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCC(CNc2cccc(OC(F)(F)C(F)F)c2)CC1 |
| InChI | InChI=1S/C18H26F4N2O3S/c1-12(2)28(25,26)24-14-8-6-13(7-9-14)11-23-15-4-3-5-16(10-15)27-18(21,22)17(19)20/h3-5,10,12-14,17,23-24H,6-9,11H2,1-2H3 |
| InChIKey | ABZWYTHVBWFTSM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|