C21H34N2O3S — CID 59230354
N-[4-[[3-(cyclopropylmethoxy)-4-methylanilino]methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 59230354) has the molecular formula C21H34N2O3S and a molecular weight of 394.58 g/mol. Its IUPAC name is N-[4-[[3-(cyclopropylmethoxy)-4-methylanilino]methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | N-[4-[[3-(cyclopropylmethoxy)-4-methylanilino]methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 59230354 |
| Molecular Formula | C21H34N2O3S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-[4-[[3-(cyclopropylmethoxy)-4-methylanilino]methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | Cc1ccc(NCC2CCC(NS(=O)(=O)C(C)C)CC2)cc1OCC1CC1 |
| InChI | InChI=1S/C21H34N2O3S/c1-15(2)27(24,25)23-19-10-7-17(8-11-19)13-22-20-9-4-16(3)21(12-20)26-14-18-5-6-18/h4,9,12,15,17-19,22-23H,5-8,10-11,13-14H2,1-3H3 |
| InChIKey | CMSRMPVYXFJEHS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |