C23H38N2O4S — CID 70939123
N-[4-[[4-(2,6-dimethyloxan-4-yl)oxyanilino]methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 70939123) has the molecular formula C23H38N2O4S and a molecular weight of 438.63 g/mol. Its IUPAC name is N-[4-[[4-(2,6-dimethyloxan-4-yl)oxyanilino]methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | N-[4-[[4-(2,6-dimethyloxan-4-yl)oxyanilino]methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70939123 |
| Molecular Formula | C23H38N2O4S |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N-[4-[[4-(2,6-dimethyloxan-4-yl)oxyanilino]methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC1CC(Oc2ccc(NCC3CCC(NS(=O)(=O)C(C)C)CC3)cc2)CC(C)O1 |
| InChI | InChI=1S/C23H38N2O4S/c1-16(2)30(26,27)25-21-7-5-19(6-8-21)15-24-20-9-11-22(12-10-20)29-23-13-17(3)28-18(4)14-23/h9-12,16-19,21,23-25H,5-8,13-15H2,1-4H3 |
| InChIKey | CHNSPCPCPLUGOP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|