C22H36FN3O3S — CID 118376791
N-[4-[[4-[(2R,6S)-3-fluoro-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 118376791) has the molecular formula C22H36FN3O3S and a molecular weight of 441.61 g/mol. Its IUPAC name is N-[4-[[4-[(2R,6S)-3-fluoro-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | N-[4-[[4-[(2R,6S)-3-fluoro-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 118376791 |
| Molecular Formula | C22H36FN3O3S |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | N-[4-[[4-[(2R,6S)-3-fluoro-2,6-dimethylmorpholin-4-yl]anilino]methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NC1CCC(CNc2ccc(N3C[C@H](C)O[C@H](C)C3F)cc2)CC1 |
| InChI | InChI=1S/C22H36FN3O3S/c1-15(2)30(27,28)25-20-7-5-18(6-8-20)13-24-19-9-11-21(12-10-19)26-14-16(3)29-17(4)22(26)23/h9-12,15-18,20,22,24-25H,5-8,13-14H2,1-4H3/t16-,17+,18?,20?,22?/m0/s1 |
| InChIKey | LIQYUXBAFWYNPM-TYYHCVQBSA-N |
| XLogP | 3.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|