C24H41N3O3S — CID 70939448
N-[4-[[4-(2,2-diethylmorpholin-4-yl)anilino]methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 70939448) has the molecular formula C24H41N3O3S and a molecular weight of 451.68 g/mol. Its IUPAC name is N-[4-[[4-(2,2-diethylmorpholin-4-yl)anilino]methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | N-[4-[[4-(2,2-diethylmorpholin-4-yl)anilino]methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70939448 |
| Molecular Formula | C24H41N3O3S |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | N-[4-[[4-(2,2-diethylmorpholin-4-yl)anilino]methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CCC1(CC)CN(c2ccc(NCC3CCC(NS(=O)(=O)C(C)C)CC3)cc2)CCO1 |
| InChI | InChI=1S/C24H41N3O3S/c1-5-24(6-2)18-27(15-16-30-24)23-13-11-21(12-14-23)25-17-20-7-9-22(10-8-20)26-31(28,29)19(3)4/h11-14,19-20,22,25-26H,5-10,15-18H2,1-4H3 |
| InChIKey | MPJVBCRTNZIIAH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|