C22H37N3O2S — CID 70939620
2-methyl-N-[4-[(4-pyrrolidin-1-ylanilino)methyl]cyclohexyl]butane-2-sulfonamide (PubChem CID 70939620) has the molecular formula C22H37N3O2S and a molecular weight of 407.62 g/mol. Its IUPAC name is 2-methyl-N-[4-[(4-pyrrolidin-1-ylanilino)methyl]cyclohexyl]butane-2-sulfonamide.
| Compound Name | 2-methyl-N-[4-[(4-pyrrolidin-1-ylanilino)methyl]cyclohexyl]butane-2-sulfonamide |
|---|---|
| PubChem CID | 70939620 |
| Molecular Formula | C22H37N3O2S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 2-methyl-N-[4-[(4-pyrrolidin-1-ylanilino)methyl]cyclohexyl]butane-2-sulfonamide |
| SMILES | CCC(C)(C)S(=O)(=O)NC1CCC(CNc2ccc(N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H37N3O2S/c1-4-22(2,3)28(26,27)24-20-9-7-18(8-10-20)17-23-19-11-13-21(14-12-19)25-15-5-6-16-25/h11-14,18,20,23-24H,4-10,15-17H2,1-3H3 |
| InChIKey | WGFSGXUILSEYPW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|