C27H49N3O3SSi — CID 59549679
N-[4-[[4-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]anilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide (PubChem CID 59549679) has the molecular formula C27H49N3O3SSi and a molecular weight of 523.86 g/mol. Its IUPAC name is N-[4-[[4-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]anilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[4-[[4-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]anilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 59549679 |
| Molecular Formula | C27H49N3O3SSi |
| Molecular Weight | 523.86 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | N-[4-[[4-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]anilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCN(c2ccc(NCC3CCC(NS(=O)(=O)C(C)(C)C)CC3)cc2)C1 |
| InChI | InChI=1S/C27H49N3O3SSi/c1-26(2,3)34(31,32)29-23-11-9-21(10-12-23)19-28-22-13-15-24(16-14-22)30-18-17-25(20-30)33-35(7,8)27(4,5)6/h13-16,21,23,25,28-29H,9-12,17-20H2,1-8H3 |
| InChIKey | CTVSZDGJLMDPDQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.86 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|