C23H39N3O4S2 — CID 70939108
4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-N-cyclohexylbenzenesulfonamide (PubChem CID 70939108) has the molecular formula C23H39N3O4S2 and a molecular weight of 485.72 g/mol. Its IUPAC name is 4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-N-cyclohexylbenzenesulfonamide.
| Compound Name | 4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-N-cyclohexylbenzenesulfonamide |
|---|---|
| PubChem CID | 70939108 |
| Molecular Formula | C23H39N3O4S2 |
| Molecular Weight | 485.72 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-N-cyclohexylbenzenesulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CCC(CNc2ccc(S(=O)(=O)NC3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C23H39N3O4S2/c1-23(2,3)32(29,30)26-21-11-9-18(10-12-21)17-24-19-13-15-22(16-14-19)31(27,28)25-20-7-5-4-6-8-20/h13-16,18,20-21,24-26H,4-12,17H2,1-3H3 |
| InChIKey | HMWOZAHERNVCQX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.72 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |