C18H28N6O2S — CID 70938893
2-methyl-N-[4-[[4-(tetrazol-2-yl)anilino]methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 70938893) has the molecular formula C18H28N6O2S and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-methyl-N-[4-[[4-(tetrazol-2-yl)anilino]methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | 2-methyl-N-[4-[[4-(tetrazol-2-yl)anilino]methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70938893 |
| Molecular Formula | C18H28N6O2S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2-methyl-N-[4-[[4-(tetrazol-2-yl)anilino]methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CCC(CNc2ccc(-n3ncnn3)cc2)CC1 |
| InChI | InChI=1S/C18H28N6O2S/c1-18(2,3)27(25,26)22-16-6-4-14(5-7-16)12-19-15-8-10-17(11-9-15)24-21-13-20-23-24/h8-11,13-14,16,19,22H,4-7,12H2,1-3H3 |
| InChIKey | YAUNIIUWNOGMMV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |