C20H35N3O4S2 — CID 70939054
4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-N-propan-2-ylbenzenesulfonamide (PubChem CID 70939054) has the molecular formula C20H35N3O4S2 and a molecular weight of 445.65 g/mol. Its IUPAC name is 4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 70939054 |
| Molecular Formula | C20H35N3O4S2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 4-[[4-(tert-butylsulfonylamino)cyclohexyl]methylamino]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NCC2CCC(NS(=O)(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H35N3O4S2/c1-15(2)22-28(24,25)19-12-10-17(11-13-19)21-14-16-6-8-18(9-7-16)23-29(26,27)20(3,4)5/h10-13,15-16,18,21-23H,6-9,14H2,1-5H3 |
| InChIKey | JCKARMPHFRBLQP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |