C20H34N2O2S — CID 70938806
2-methyl-N-[4-[(4-propan-2-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 70938806) has the molecular formula C20H34N2O2S and a molecular weight of 366.57 g/mol. Its IUPAC name is 2-methyl-N-[4-[(4-propan-2-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | 2-methyl-N-[4-[(4-propan-2-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70938806 |
| Molecular Formula | C20H34N2O2S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-methyl-N-[4-[(4-propan-2-ylanilino)methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)c1ccc(NCC2CCC(NS(=O)(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H34N2O2S/c1-15(2)17-8-12-18(13-9-17)21-14-16-6-10-19(11-7-16)22-25(23,24)20(3,4)5/h8-9,12-13,15-16,19,21-22H,6-7,10-11,14H2,1-5H3 |
| InChIKey | MADGCLNTPMWUKR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |