C19H33N3O2S — CID 70938718
N-[4-[[3-(dimethylamino)anilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide (PubChem CID 70938718) has the molecular formula C19H33N3O2S and a molecular weight of 367.56 g/mol. Its IUPAC name is N-[4-[[3-(dimethylamino)anilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[4-[[3-(dimethylamino)anilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 70938718 |
| Molecular Formula | C19H33N3O2S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-[4-[[3-(dimethylamino)anilino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide |
| SMILES | CN(C)c1cccc(NCC2CCC(NS(=O)(=O)C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H33N3O2S/c1-19(2,3)25(23,24)21-16-11-9-15(10-12-16)14-20-17-7-6-8-18(13-17)22(4)5/h6-8,13,15-16,20-21H,9-12,14H2,1-5H3 |
| InChIKey | FHQLZHSLOSPIEF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |