C19H32FN3O2S — CID 70939338
N-[4-[[2-(4-fluoroanilino)ethylamino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide (PubChem CID 70939338) has the molecular formula C19H32FN3O2S and a molecular weight of 385.55 g/mol. Its IUPAC name is N-[4-[[2-(4-fluoroanilino)ethylamino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[4-[[2-(4-fluoroanilino)ethylamino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 70939338 |
| Molecular Formula | C19H32FN3O2S |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[4-[[2-(4-fluoroanilino)ethylamino]methyl]cyclohexyl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CCC(CNCCNc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H32FN3O2S/c1-19(2,3)26(24,25)23-18-8-4-15(5-9-18)14-21-12-13-22-17-10-6-16(20)7-11-17/h6-7,10-11,15,18,21-23H,4-5,8-9,12-14H2,1-3H3 |
| InChIKey | POGWYTJOXHLGTI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|