C18H37N3O3S — CID 70938726
2-methyl-N-[4-[(3-morpholin-4-ylpropylamino)methyl]cyclohexyl]propane-2-sulfonamide (PubChem CID 70938726) has the molecular formula C18H37N3O3S and a molecular weight of 375.58 g/mol. Its IUPAC name is 2-methyl-N-[4-[(3-morpholin-4-ylpropylamino)methyl]cyclohexyl]propane-2-sulfonamide.
| Compound Name | 2-methyl-N-[4-[(3-morpholin-4-ylpropylamino)methyl]cyclohexyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70938726 |
| Molecular Formula | C18H37N3O3S |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 2-methyl-N-[4-[(3-morpholin-4-ylpropylamino)methyl]cyclohexyl]propane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NC1CCC(CNCCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C18H37N3O3S/c1-18(2,3)25(22,23)20-17-7-5-16(6-8-17)15-19-9-4-10-21-11-13-24-14-12-21/h16-17,19-20H,4-15H2,1-3H3 |
| InChIKey | KWCOEGJJUNRDHV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|