C21H29N3O — CID 59231458
4-[[4-(2,2-diethylmorpholin-4-yl)anilino]methyl]aniline (PubChem CID 59231458) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-[[4-(2,2-diethylmorpholin-4-yl)anilino]methyl]aniline.
| Compound Name | 4-[[4-(2,2-diethylmorpholin-4-yl)anilino]methyl]aniline |
|---|---|
| PubChem CID | 59231458 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 4-[[4-(2,2-diethylmorpholin-4-yl)anilino]methyl]aniline |
| SMILES | CCC1(CC)CN(c2ccc(NCc3ccc(N)cc3)cc2)CCO1 |
| InChI | InChI=1S/C21H29N3O/c1-3-21(4-2)16-24(13-14-25-21)20-11-9-19(10-12-20)23-15-17-5-7-18(22)8-6-17/h5-12,23H,3-4,13-16,22H2,1-2H3 |
| InChIKey | RZFRVHCSLHQUJR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|