C26H43NO3S — CID 159335075
2,2-diethyl-4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine (PubChem CID 159335075) has the molecular formula C26H43NO3S and a molecular weight of 449.70 g/mol. Its IUPAC name is 2,2-diethyl-4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine.
| Compound Name | 2,2-diethyl-4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine |
|---|---|
| PubChem CID | 159335075 |
| Molecular Formula | C26H43NO3S |
| Molecular Weight | 449.70 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 2,2-diethyl-4-[4-[2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]morpholine |
| SMILES | CCC1(CC)CN(c2ccc(CCC3CCC(CS(=O)(=O)C(C)C)CC3)cc2)CCO1 |
| InChI | InChI=1S/C26H43NO3S/c1-5-26(6-2)20-27(17-18-30-26)25-15-13-23(14-16-25)8-7-22-9-11-24(12-10-22)19-31(28,29)21(3)4/h13-16,21-22,24H,5-12,17-20H2,1-4H3 |
| InChIKey | BZEPWQOSGPUVGH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.70 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|