C22H33NO3S — CID 58144336
1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]-2-(4-pyrrolidin-1-ylphenyl)ethanone (PubChem CID 58144336) has the molecular formula C22H33NO3S and a molecular weight of 391.58 g/mol. Its IUPAC name is 1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]-2-(4-pyrrolidin-1-ylphenyl)ethanone.
| Compound Name | 1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]-2-(4-pyrrolidin-1-ylphenyl)ethanone |
|---|---|
| PubChem CID | 58144336 |
| Molecular Formula | C22H33NO3S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]-2-(4-pyrrolidin-1-ylphenyl)ethanone |
| SMILES | CC(C)S(=O)(=O)CC1CCC(C(=O)Cc2ccc(N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H33NO3S/c1-17(2)27(25,26)16-19-5-9-20(10-6-19)22(24)15-18-7-11-21(12-8-18)23-13-3-4-14-23/h7-8,11-12,17,19-20H,3-6,9-10,13-16H2,1-2H3 |
| InChIKey | PJRPVTNEPWHHSI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|