C25H30O4S — CID 58145056
2-(4-benzoylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone (PubChem CID 58145056) has the molecular formula C25H30O4S and a molecular weight of 426.58 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone.
| Compound Name | 2-(4-benzoylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 58145056 |
| Molecular Formula | C25H30O4S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-(4-benzoylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
| SMILES | CC(C)S(=O)(=O)CC1CCC(C(=O)Cc2ccc(C(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H30O4S/c1-18(2)30(28,29)17-20-10-12-21(13-11-20)24(26)16-19-8-14-23(15-9-19)25(27)22-6-4-3-5-7-22/h3-9,14-15,18,20-21H,10-13,16-17H2,1-2H3 |
| InChIKey | LKHUJEFIDXKCAP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |