C25H30O3S — CID 58145395
2-(9H-fluoren-9-yl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone (PubChem CID 58145395) has the molecular formula C25H30O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is 2-(9H-fluoren-9-yl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone.
| Compound Name | 2-(9H-fluoren-9-yl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 58145395 |
| Molecular Formula | C25H30O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-(9H-fluoren-9-yl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
| SMILES | CC(C)S(=O)(=O)CC1CCC(C(=O)CC2c3ccccc3-c3ccccc32)CC1 |
| InChI | InChI=1S/C25H30O3S/c1-17(2)29(27,28)16-18-11-13-19(14-12-18)25(26)15-24-22-9-5-3-7-20(22)21-8-4-6-10-23(21)24/h3-10,17-19,24H,11-16H2,1-2H3 |
| InChIKey | UFONSBPEDAWUOC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |