C26H30O3S — CID 58145744
2-anthracen-1-yl-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone (PubChem CID 58145744) has the molecular formula C26H30O3S and a molecular weight of 422.59 g/mol. Its IUPAC name is 2-anthracen-1-yl-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone.
| Compound Name | 2-anthracen-1-yl-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 58145744 |
| Molecular Formula | C26H30O3S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-anthracen-1-yl-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
| SMILES | CC(C)S(=O)(=O)CC1CCC(C(=O)Cc2cccc3cc4ccccc4cc23)CC1 |
| InChI | InChI=1S/C26H30O3S/c1-18(2)30(28,29)17-19-10-12-20(13-11-19)26(27)16-24-9-5-8-23-14-21-6-3-4-7-22(21)15-25(23)24/h3-9,14-15,18-20H,10-13,16-17H2,1-2H3 |
| InChIKey | JHLBZIKKTITYEJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|