C19H27FO3S — CID 58143982
2-(3-fluoro-4-methylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone (PubChem CID 58143982) has the molecular formula C19H27FO3S and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-(3-fluoro-4-methylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone.
| Compound Name | 2-(3-fluoro-4-methylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 58143982 |
| Molecular Formula | C19H27FO3S |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-(3-fluoro-4-methylphenyl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
| SMILES | Cc1ccc(CC(=O)C2CCC(CS(=O)(=O)C(C)C)CC2)cc1F |
| InChI | InChI=1S/C19H27FO3S/c1-13(2)24(22,23)12-15-6-8-17(9-7-15)19(21)11-16-5-4-14(3)18(20)10-16/h4-5,10,13,15,17H,6-9,11-12H2,1-3H3 |
| InChIKey | RDEUPBOLUHJUHY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |