C21H30O4S — CID 58145544
1-[3-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]propan-2-one (PubChem CID 58145544) has the molecular formula C21H30O4S and a molecular weight of 378.53 g/mol. Its IUPAC name is 1-[3-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]propan-2-one.
| Compound Name | 1-[3-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]propan-2-one |
|---|---|
| PubChem CID | 58145544 |
| Molecular Formula | C21H30O4S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-[3-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]phenyl]propan-2-one |
| SMILES | CC(=O)Cc1cccc(CC(=O)C2CCC(CS(=O)(=O)C(C)C)CC2)c1 |
| InChI | InChI=1S/C21H30O4S/c1-15(2)26(24,25)14-17-7-9-20(10-8-17)21(23)13-19-6-4-5-18(12-19)11-16(3)22/h4-6,12,15,17,20H,7-11,13-14H2,1-3H3 |
| InChIKey | XKKNJSHLJNQCMU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |