C23H30O3S — CID 58145597
3-naphthalen-1-yl-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]propan-1-one (PubChem CID 58145597) has the molecular formula C23H30O3S and a molecular weight of 386.56 g/mol. Its IUPAC name is 3-naphthalen-1-yl-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]propan-1-one.
| Compound Name | 3-naphthalen-1-yl-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]propan-1-one |
|---|---|
| PubChem CID | 58145597 |
| Molecular Formula | C23H30O3S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 3-naphthalen-1-yl-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]propan-1-one |
| SMILES | CC(C)S(=O)(=O)CC1CCC(C(=O)CCc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C23H30O3S/c1-17(2)27(25,26)16-18-10-12-21(13-11-18)23(24)15-14-20-8-5-7-19-6-3-4-9-22(19)20/h3-9,17-18,21H,10-16H2,1-2H3 |
| InChIKey | ZLHMZYKKWVBNAV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |