C20H26O3S2 — CID 58143898
2-(1-benzothiophen-5-yl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone (PubChem CID 58143898) has the molecular formula C20H26O3S2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 2-(1-benzothiophen-5-yl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone.
| Compound Name | 2-(1-benzothiophen-5-yl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 58143898 |
| Molecular Formula | C20H26O3S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-(1-benzothiophen-5-yl)-1-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethanone |
| SMILES | CC(C)S(=O)(=O)CC1CCC(C(=O)Cc2ccc3sccc3c2)CC1 |
| InChI | InChI=1S/C20H26O3S2/c1-14(2)25(22,23)13-15-3-6-17(7-4-15)19(21)12-16-5-8-20-18(11-16)9-10-24-20/h5,8-11,14-15,17H,3-4,6-7,12-13H2,1-2H3 |
| InChIKey | ZPDJGPHYZHLUPM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |