C23H28O6S — CID 58143893
3-acetyl-6-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]chromen-2-one (PubChem CID 58143893) has the molecular formula C23H28O6S and a molecular weight of 432.54 g/mol. Its IUPAC name is 3-acetyl-6-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]chromen-2-one.
| Compound Name | 3-acetyl-6-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]chromen-2-one |
|---|---|
| PubChem CID | 58143893 |
| Molecular Formula | C23H28O6S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 3-acetyl-6-[2-oxo-2-[4-(propan-2-ylsulfonylmethyl)cyclohexyl]ethyl]chromen-2-one |
| SMILES | CC(=O)c1cc2cc(CC(=O)C3CCC(CS(=O)(=O)C(C)C)CC3)ccc2oc1=O |
| InChI | InChI=1S/C23H28O6S/c1-14(2)30(27,28)13-16-4-7-18(8-5-16)21(25)11-17-6-9-22-19(10-17)12-20(15(3)24)23(26)29-22/h6,9-10,12,14,16,18H,4-5,7-8,11,13H2,1-3H3 |
| InChIKey | VMJVISMWAICRMO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|