C23H24O3S — CID 59545602
3-acetyl-6-[2-[4-(propan-2-ylsulfanylmethyl)phenyl]ethyl]chromen-2-one (PubChem CID 59545602) has the molecular formula C23H24O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is 3-acetyl-6-[2-[4-(propan-2-ylsulfanylmethyl)phenyl]ethyl]chromen-2-one.
| Compound Name | 3-acetyl-6-[2-[4-(propan-2-ylsulfanylmethyl)phenyl]ethyl]chromen-2-one |
|---|---|
| PubChem CID | 59545602 |
| Molecular Formula | C23H24O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 3-acetyl-6-[2-[4-(propan-2-ylsulfanylmethyl)phenyl]ethyl]chromen-2-one |
| SMILES | CC(=O)c1cc2cc(CCc3ccc(CSC(C)C)cc3)ccc2oc1=O |
| InChI | InChI=1S/C23H24O3S/c1-15(2)27-14-19-8-5-17(6-9-19)4-7-18-10-11-22-20(12-18)13-21(16(3)24)23(25)26-22/h5-6,8-13,15H,4,7,14H2,1-3H3 |
| InChIKey | KSEKUBGVVCVUON-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|