C19H29NO3S — CID 58145405
2-(3-aminophenyl)-1-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethanone (PubChem CID 58145405) has the molecular formula C19H29NO3S and a molecular weight of 351.51 g/mol. Its IUPAC name is 2-(3-aminophenyl)-1-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethanone.
| Compound Name | 2-(3-aminophenyl)-1-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 58145405 |
| Molecular Formula | C19H29NO3S |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 2-(3-aminophenyl)-1-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethanone |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCC(C(=O)Cc2cccc(N)c2)CC1 |
| InChI | InChI=1S/C19H29NO3S/c1-19(2,3)24(22,23)13-14-7-9-16(10-8-14)18(21)12-15-5-4-6-17(20)11-15/h4-6,11,14,16H,7-10,12-13,20H2,1-3H3 |
| InChIKey | AWLMYWYIRIBDEZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|