C25H38O4S — CID 58144955
1-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-(3-cyclohexyloxyphenyl)ethanone (PubChem CID 58144955) has the molecular formula C25H38O4S and a molecular weight of 434.64 g/mol. Its IUPAC name is 1-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-(3-cyclohexyloxyphenyl)ethanone.
| Compound Name | 1-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-(3-cyclohexyloxyphenyl)ethanone |
|---|---|
| PubChem CID | 58144955 |
| Molecular Formula | C25H38O4S |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 1-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-(3-cyclohexyloxyphenyl)ethanone |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCC(C(=O)Cc2cccc(OC3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C25H38O4S/c1-25(2,3)30(27,28)18-19-12-14-21(15-13-19)24(26)17-20-8-7-11-23(16-20)29-22-9-5-4-6-10-22/h7-8,11,16,19,21-22H,4-6,9-10,12-15,17-18H2,1-3H3 |
| InChIKey | ZJVKUKQAVIEKJS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |