C24H35NO4S — CID 58145747
1-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxoethyl]phenyl]piperidin-2-one (PubChem CID 58145747) has the molecular formula C24H35NO4S and a molecular weight of 433.61 g/mol. Its IUPAC name is 1-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxoethyl]phenyl]piperidin-2-one.
| Compound Name | 1-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxoethyl]phenyl]piperidin-2-one |
|---|---|
| PubChem CID | 58145747 |
| Molecular Formula | C24H35NO4S |
| Molecular Weight | 433.61 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 1-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]-2-oxoethyl]phenyl]piperidin-2-one |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCC(C(=O)Cc2ccc(N3CCCCC3=O)cc2)CC1 |
| InChI | InChI=1S/C24H35NO4S/c1-24(2,3)30(28,29)17-19-7-11-20(12-8-19)22(26)16-18-9-13-21(14-10-18)25-15-5-4-6-23(25)27/h9-10,13-14,19-20H,4-8,11-12,15-17H2,1-3H3 |
| InChIKey | SKPWFNYJMOSYLP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |