C23H36O3S — CID 58145202
2-(4-tert-butylphenyl)-1-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethanone (PubChem CID 58145202) has the molecular formula C23H36O3S and a molecular weight of 392.61 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-1-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethanone.
| Compound Name | 2-(4-tert-butylphenyl)-1-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 58145202 |
| Molecular Formula | C23H36O3S |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 2-(4-tert-butylphenyl)-1-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethanone |
| SMILES | CC(C)(C)c1ccc(CC(=O)C2CCC(CS(=O)(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H36O3S/c1-22(2,3)20-13-9-17(10-14-20)15-21(24)19-11-7-18(8-12-19)16-27(25,26)23(4,5)6/h9-10,13-14,18-19H,7-8,11-12,15-16H2,1-6H3 |
| InChIKey | ZDVUNQYGUNTSJG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |