C23H38O2S — CID 159436569
1-tert-butyl-4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]benzene (PubChem CID 159436569) has the molecular formula C23H38O2S and a molecular weight of 378.62 g/mol. Its IUPAC name is 1-tert-butyl-4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]benzene.
| Compound Name | 1-tert-butyl-4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 159436569 |
| Molecular Formula | C23H38O2S |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 1-tert-butyl-4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]benzene |
| SMILES | CC(C)(C)c1ccc(CCC2CCC(CS(=O)(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H38O2S/c1-22(2,3)21-15-13-19(14-16-21)8-7-18-9-11-20(12-10-18)17-26(24,25)23(4,5)6/h13-16,18,20H,7-12,17H2,1-6H3 |
| InChIKey | BFGLNZSXWCWYJL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |