C25H35NO4S2 — CID 159676905
N-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]phenyl]benzenesulfonamide (PubChem CID 159676905) has the molecular formula C25H35NO4S2 and a molecular weight of 477.69 g/mol. Its IUPAC name is N-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 159676905 |
| Molecular Formula | C25H35NO4S2 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | N-[4-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]phenyl]benzenesulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCC(CCc2ccc(NS(=O)(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C25H35NO4S2/c1-25(2,3)31(27,28)19-22-13-11-20(12-14-22)9-10-21-15-17-23(18-16-21)26-32(29,30)24-7-5-4-6-8-24/h4-8,15-18,20,22,26H,9-14,19H2,1-3H3 |
| InChIKey | VTQJYIVCISGVLN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |