C19H31NO2S — CID 159572210
3-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]aniline (PubChem CID 159572210) has the molecular formula C19H31NO2S and a molecular weight of 337.53 g/mol. Its IUPAC name is 3-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]aniline.
| Compound Name | 3-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]aniline |
|---|---|
| PubChem CID | 159572210 |
| Molecular Formula | C19H31NO2S |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 3-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]aniline |
| SMILES | CC(C)(C)S(=O)(=O)CC1CCC(CCc2cccc(N)c2)CC1 |
| InChI | InChI=1S/C19H31NO2S/c1-19(2,3)23(21,22)14-17-11-8-15(9-12-17)7-10-16-5-4-6-18(20)13-16/h4-6,13,15,17H,7-12,14,20H2,1-3H3 |
| InChIKey | FMERWLRPDAOLSK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|