C23H37NO3S — CID 59545980
3-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]-N-propan-2-ylbenzamide (PubChem CID 59545980) has the molecular formula C23H37NO3S and a molecular weight of 407.62 g/mol. Its IUPAC name is 3-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]-N-propan-2-ylbenzamide.
| Compound Name | 3-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 59545980 |
| Molecular Formula | C23H37NO3S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 3-[2-[4-(tert-butylsulfonylmethyl)cyclohexyl]ethyl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cccc(CCC2CCC(CS(=O)(=O)C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C23H37NO3S/c1-17(2)24-22(25)21-8-6-7-19(15-21)12-9-18-10-13-20(14-11-18)16-28(26,27)23(3,4)5/h6-8,15,17-18,20H,9-14,16H2,1-5H3,(H,24,25) |
| InChIKey | IFOXUHJFBPTMIC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |