C23H29NO4S — CID 58145111
3-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-N-propan-2-ylbenzamide (PubChem CID 58145111) has the molecular formula C23H29NO4S and a molecular weight of 415.56 g/mol. Its IUPAC name is 3-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-N-propan-2-ylbenzamide.
| Compound Name | 3-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 58145111 |
| Molecular Formula | C23H29NO4S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-[2-[4-(tert-butylsulfonylmethyl)phenyl]-2-oxoethyl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cccc(CC(=O)c2ccc(CS(=O)(=O)C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C23H29NO4S/c1-16(2)24-22(26)20-8-6-7-18(13-20)14-21(25)19-11-9-17(10-12-19)15-29(27,28)23(3,4)5/h6-13,16H,14-15H2,1-5H3,(H,24,26) |
| InChIKey | RATVSZFSHBFHKZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |