C20H21F3O3S — CID 58145636
1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 58145636) has the molecular formula C20H21F3O3S and a molecular weight of 398.45 g/mol. Its IUPAC name is 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 58145636 |
| Molecular Formula | C20H21F3O3S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-[4-(tert-butylsulfonylmethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | CC(C)(C)S(=O)(=O)Cc1ccc(C(=O)Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H21F3O3S/c1-19(2,3)27(25,26)13-14-7-9-16(10-8-14)18(24)12-15-5-4-6-17(11-15)20(21,22)23/h4-11H,12-13H2,1-3H3 |
| InChIKey | SXGAJTFEHAHTDY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |