C15H11ClF3NO — CID 116581836
1-(4-amino-3-chlorophenyl)-2-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 116581836) has the molecular formula C15H11ClF3NO and a molecular weight of 313.71 g/mol. Its IUPAC name is 1-(4-amino-3-chlorophenyl)-2-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-(4-amino-3-chlorophenyl)-2-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 116581836 |
| Molecular Formula | C15H11ClF3NO |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-(4-amino-3-chlorophenyl)-2-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | Nc1ccc(C(=O)Cc2cccc(C(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C15H11ClF3NO/c16-12-8-10(4-5-13(12)20)14(21)7-9-2-1-3-11(6-9)15(17,18)19/h1-6,8H,7,20H2 |
| InChIKey | PMSFQNGQAQKYGT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|