C21H33NO4S — CID 58144582
3-(7-tert-butylsulfonyl-2-oxoheptyl)-N-propan-2-ylbenzamide (PubChem CID 58144582) has the molecular formula C21H33NO4S and a molecular weight of 395.57 g/mol. Its IUPAC name is 3-(7-tert-butylsulfonyl-2-oxoheptyl)-N-propan-2-ylbenzamide.
| Compound Name | 3-(7-tert-butylsulfonyl-2-oxoheptyl)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 58144582 |
| Molecular Formula | C21H33NO4S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 3-(7-tert-butylsulfonyl-2-oxoheptyl)-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cccc(CC(=O)CCCCCS(=O)(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H33NO4S/c1-16(2)22-20(24)18-11-9-10-17(14-18)15-19(23)12-7-6-8-13-27(25,26)21(3,4)5/h9-11,14,16H,6-8,12-13,15H2,1-5H3,(H,22,24) |
| InChIKey | XAWSKCLFKUIGKN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|