C19H28O4S — CID 58143744
1-(3-acetylphenyl)-7-tert-butylsulfonylheptan-2-one (PubChem CID 58143744) has the molecular formula C19H28O4S and a molecular weight of 352.50 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-7-tert-butylsulfonylheptan-2-one.
| Compound Name | 1-(3-acetylphenyl)-7-tert-butylsulfonylheptan-2-one |
|---|---|
| PubChem CID | 58143744 |
| Molecular Formula | C19H28O4S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-(3-acetylphenyl)-7-tert-butylsulfonylheptan-2-one |
| SMILES | CC(=O)c1cccc(CC(=O)CCCCCS(=O)(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C19H28O4S/c1-15(20)17-10-8-9-16(13-17)14-18(21)11-6-5-7-12-24(22,23)19(2,3)4/h8-10,13H,5-7,11-12,14H2,1-4H3 |
| InChIKey | PXBFBFZSSPVLMG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|